CAS 1185297-19-1

Piperidine, 4-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a para-substituted phenyl group with a tert-butyl group, enhancing its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in numerous bioactive compounds. This compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Its structural characteristics may influence its interaction with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₅H₂₃N·ClH

InChI: InChI=1S/C15H23N.ClH/c1-15(2,3)14-6-4-12(5-7-14)13-8-10-16-11-9-13;/h4-7,13,16H,8-11H2,1-3H3;1H

InChI key: InChIKey=SVBRQNCYCDAEGJ-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=CC=C(C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

4-(4-tert-Butylphenyl)piperidine hydrochloride

CAS: 1185297-19-1

Versatile small molecule scaffold

Formula: C₁₅H₂₄ClN

Purity: Min. 95%

Molecular weight: 253.81 g/mol

Ref: 3D-KXB29719