CAS 1185297-49-7

Piperidine, 3-(3-bromophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 3-(3-bromophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 3-bromophenoxy group, indicating the presence of a bromine atom on a phenyl ring that is ether-linked to the piperidine. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. The presence of the bromine substituent may also impart unique reactivity or binding characteristics. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Proper storage conditions are essential to maintain stability and prevent degradation.

Formula: C₁₁H₁₄BrNO·ClH

InChI: InChI=1S/C11H14BrNO.ClH/c12-9-3-1-4-10(7-9)14-11-5-2-6-13-8-11;/h1,3-4,7,11,13H,2,5-6,8H2;1H

InChI key: InChIKey=OGFFOJZJLMJTRW-UHFFFAOYSA-N

SMILES: O(C1=CC(Br)=CC=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(3-bromophenoxy)-, hydrochloride (1:1)

3-(3-Bromophenoxy)piperidine hydrochloride

CAS: 1185297-49-7

Please enquire for more information about 3-(3-Bromophenoxy)piperidine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₅BrClNO

Purity: Min. 95%

Molecular weight: 292.6 g/mol

Ref: 3D-KXB29749