CymitQuimica logo

CAS 1185297-60-2

:

Piperidine, 3-[[(3-methyl-2-buten-1-yl)oxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[[[3-methyl-2-buten-1-yl]oxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a 3-methyl-2-buten-1-yl group indicates that it has an alkyl substituent that contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Its structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and applications.
Formula:C11H21NO·ClH
InChI:InChI=1S/C11H21NO.ClH/c1-10(2)5-7-13-9-11-4-3-6-12-8-11;/h5,11-12H,3-4,6-9H2,1-2H3;1H
InChI key:InChIKey=RQBSLFVSHFYSIR-UHFFFAOYSA-N
SMILES:C(OCC=C(C)C)C1CCCNC1.Cl
Synonyms:
  • Piperidine, 3-[[(3-methyl-2-buten-1-yl)oxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.