
CAS 1185297-61-3
:Quinoline, 8-(4-piperidinyloxy)-, hydrochloride (1:2)
Description:
Quinoline, 8-(4-piperidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure known for its heterocyclic properties. The presence of a piperidinyloxy group at the 8-position of the quinoline ring enhances its potential for biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various pharmacological properties, including potential roles as an antimicrobial or antitumor agent, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it may interact with biological targets through mechanisms typical of quinoline derivatives, such as enzyme inhibition or receptor modulation. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory or industrial settings.
Formula:C14H16N2O·2ClH
InChI:InChI=1S/C14H16N2O.2ClH/c1-3-11-4-2-8-16-14(11)13(5-1)17-12-6-9-15-10-7-12;;/h1-5,8,12,15H,6-7,9-10H2;2*1H
InChI key:InChIKey=FWGWDPQQPJCLDZ-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=CC1)C=CC=N2)C3CCNCC3.Cl
Synonyms:- Quinoline, 8-(4-piperidinyloxy)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.