
CAS 1185297-62-4
:Benzenamine, 4-(2-propoxyethoxy)-2-(trifluoromethyl)-, hydrochloride (1:1)
Description:
Benzenamine, 4-(2-propoxyethoxy)-2-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1185297-62-4, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a trifluoromethyl group and a propoxyethoxy side chain. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. The compound's amine functionality suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the presence of the ether linkage in the propoxyethoxy group may impart unique properties, such as improved solubility and stability. Overall, this compound's structural features suggest it may exhibit interesting chemical behavior and potential utility in medicinal chemistry or material science. However, specific safety and handling guidelines should be consulted due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C12H16F3NO2·ClH
InChI:InChI=1S/C12H16F3NO2.ClH/c1-2-5-17-6-7-18-9-3-4-11(16)10(8-9)12(13,14)15;/h3-4,8H,2,5-7,16H2,1H3;1H
InChI key:InChIKey=HCGWIPSEIVGMMY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(OCCOCCC)=CC=C1N.Cl
Synonyms:- Benzenamine, 4-(2-propoxyethoxy)-2-(trifluoromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.