
CAS 1185297-63-5
:Piperidine, 4-[(2-methoxyethoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-methoxyethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 2-methoxyethoxy group indicates that it has ether functionalities, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a pharmacologically active agent, depending on its specific applications. Its molecular structure suggests it could interact with biological systems, possibly influencing neurotransmitter pathways due to the piperidine moiety. The hydrochloride form often enhances the compound's stability and bioavailability, making it suitable for various chemical and pharmaceutical applications. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H19NO2·ClH
InChI:InChI=1S/C9H19NO2.ClH/c1-11-6-7-12-8-9-2-4-10-5-3-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=VSDDNNFKIUVBDK-UHFFFAOYSA-N
SMILES:C(OCCOC)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-[(2-methoxyethoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.