CymitQuimica logo

CAS 1185297-65-7

:

Piperidine, 2-(2-propoxyethyl)-, hydrochloride (1:1)

Description:
Piperidine, 2-(2-propoxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a propoxyethyl side chain, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various pharmaceutical formulations. The presence of the hydrochloride group also indicates that the compound can exhibit basic properties, allowing it to interact with acids and bases. Piperidine derivatives are often studied for their biological activities, including potential roles in medicinal chemistry, where they may act as intermediates or active pharmaceutical ingredients. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound's structure and properties suggest it may have relevance in research and development within the fields of organic chemistry and pharmacology.
Formula:C10H21NO·ClH
InChI:InChI=1S/C10H21NO.ClH/c1-2-8-12-9-6-10-5-3-4-7-11-10;/h10-11H,2-9H2,1H3;1H
InChI key:InChIKey=DPXPBSZVLDZKEZ-UHFFFAOYSA-N
SMILES:C(COCCC)C1CCCCN1.Cl
Synonyms:
  • Piperidine, 2-(2-propoxyethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.