CAS 1185297-69-1

Piperidine, 4-[(3-chlorophenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-chlorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 3-chlorophenoxy group attached to the piperidine at the 4-position, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical formulations. The presence of the chlorophenoxy moiety may impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential uses in drug development, particularly in the context of neuropharmacology or as a building block for synthesizing more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₂H₁₆ClNO·ClH

InChI: InChI=1S/C12H16ClNO.ClH/c13-11-2-1-3-12(8-11)15-9-10-4-6-14-7-5-10;/h1-3,8,10,14H,4-7,9H2;1H

InChI key: InChIKey=ASXBAVLNZAPPII-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• Piperidine, 4-[(3-chlorophenoxy)methyl]-, hydrochloride (1:1)