CAS 1185297-72-6

Pyrrolidine, 3-[(2-methylphenyl)methoxy]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(2-methylphenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a methoxy group attached to a 2-methylphenyl moiety indicates that this compound has both aromatic and aliphatic characteristics, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its structure suggests it could interact with biological systems. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity. Its specific applications, pharmacological effects, and safety profile would require further investigation through empirical studies and literature review.

Formula: C₁₂H₁₇NO·ClH

InChI: InChI=1S/C12H17NO.ClH/c1-10-4-2-3-5-11(10)9-14-12-6-7-13-8-12;/h2-5,12-13H,6-9H2,1H3;1H

InChI key: InChIKey=YMBVUVMWBZPSCM-UHFFFAOYSA-N

SMILES: C(OC1CCNC1)C2=C(C)C=CC=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(2-methylphenyl)methoxy]-, hydrochloride (1:1)