CymitQuimica logo

CAS 1185297-81-7

:

Pyrrolidine, 3-[(2-methyl-2-propen-1-yl)oxy]-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-[(2-methyl-2-propen-1-yl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 2-methyl-2-propen-1-yl group, also known as an isopropenyl group, indicates that this compound has potential reactivity due to the double bond, which can participate in various chemical reactions, such as polymerization or electrophilic addition. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it more stable for storage and handling. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H15NO·ClH
InChI:InChI=1S/C8H15NO.ClH/c1-7(2)6-10-8-3-4-9-5-8;/h8-9H,1,3-6H2,2H3;1H
InChI key:InChIKey=XIUCKVDZSDZVBT-UHFFFAOYSA-N
SMILES:O(CC(C)=C)C1CCNC1.Cl
Synonyms:
  • Pyrrolidine, 3-[(2-methyl-2-propen-1-yl)oxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.