
CAS 1185297-83-9
:1H-Indol-5-amine, 2-methyl-1-propyl-, hydrochloride (1:1)
Description:
1H-Indol-5-amine, 2-methyl-1-propyl-, hydrochloride (1:1), with the CAS number 1185297-83-9, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features an amine group at the 5-position of the indole, along with a 2-methyl-1-propyl substituent, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and research. The presence of the amine group suggests potential basicity and reactivity, making it a candidate for further chemical modifications or interactions. Its structural features may also impart biological activity, which could be of interest in medicinal chemistry. Overall, this compound's characteristics, including solubility, reactivity, and potential biological effects, make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C12H16N2·ClH
InChI:InChI=1S/C12H16N2.ClH/c1-3-6-14-9(2)7-10-8-11(13)4-5-12(10)14;/h4-5,7-8H,3,6,13H2,1-2H3;1H
InChI key:InChIKey=DKFGAVWGKURYPW-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(C=C1C)=CC(N)=CC2.Cl
Synonyms:- 1H-Indol-5-amine, 2-methyl-1-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.