CymitQuimica logo

CAS 1185297-87-3

:

2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4,5-trimethoxybenzoic acid

Description:
2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4,5-trimethoxybenzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with multiple methoxy groups and an amino group that is further modified by a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential solubility in organic solvents. The presence of methoxy groups enhances its lipophilicity, while the carboxylic acid group provides acidic characteristics, allowing for potential interactions in biological systems. The dimethylethoxycarbonyl group serves as a protective or modifying group, which can influence the compound's reactivity and stability. Such compounds may be of interest in medicinal chemistry for their potential biological activities, including anti-inflammatory or anticancer properties, due to the structural motifs that can interact with biological targets. Overall, the compound's unique combination of functional groups suggests a versatile role in various chemical and pharmaceutical applications.
Formula:C15H21NO7
InChI:InChI=1S/C15H21NO7/c1-15(2,3)23-14(19)16-10-8(13(17)18)7-9(20-4)11(21-5)12(10)22-6/h7H,1-6H3,(H,16,19)(H,17,18)
InChI key:InChIKey=FQBFMANNSTYZMD-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(OC)C(OC)=C(OC)C=C1C(O)=O
Synonyms:
  • 2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4,5-trimethoxybenzoic acid
  • Benzoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-3,4,5-trimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.