CAS 1185297-89-5

Benzoic acid, 3-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 3-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzoic acid moiety, a piperidine ring, and a methyl ester functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The piperidinyloxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further studies. Its hydrochloride form indicates that it is a salt, which can influence its stability and solubility in various solvents. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Safety data sheets should be consulted for information on toxicity and safe handling practices.

Formula: C₁₃H₁₇NO₃·ClH

InChI: InChI=1S/C13H17NO3.ClH/c1-16-13(15)10-4-2-5-11(8-10)17-12-6-3-7-14-9-12;/h2,4-5,8,12,14H,3,6-7,9H2,1H3;1H

InChI key: InChIKey=ATRARGAVSBJMSN-UHFFFAOYSA-N

SMILES: O(C1=CC(C(OC)=O)=CC=C1)C2CCCNC2.Cl

Synonyms:

• Benzoic acid, 3-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1)