CAS 1185298-03-6

Piperidine, 2-(4-ethoxyphenyl)-, hydrochloride (1:1)

Description:

Piperidine, 2-(4-ethoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-ethoxyphenyl group indicates that there is an ethoxy substituent attached to a phenyl ring at the para position relative to the nitrogen in the piperidine structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular structure suggests it could interact with various receptors or enzymes, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry would be essential for confirming its identity and purity in research and industrial applications.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-2-15-12-8-6-11(7-9-12)13-5-3-4-10-14-13;/h6-9,13-14H,2-5,10H2,1H3;1H

InChI key: InChIKey=HARCFONFAOOIKC-UHFFFAOYSA-N

SMILES: O(CC)C1=CC=C(C=C1)C2CCCCN2.Cl

Synonyms:

• Piperidine, 2-(4-ethoxyphenyl)-, hydrochloride (1:1)