
CAS 1185298-07-0
:Pyrrolidine, 3-(2-bromo-4-methylphenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2-bromo-4-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2-bromo-4-methylphenoxy group indicates that the compound has a bromine atom and a methyl group attached to a phenoxy moiety, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity, potentially influencing its use in medicinal chemistry. Its molecular structure suggests it could interact with biological targets, making it of interest for research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents, which can affect toxicity and reactivity. Overall, this compound represents a specific class of organic molecules with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C11H14BrNO·ClH
InChI:InChI=1S/C11H14BrNO.ClH/c1-8-2-3-11(10(12)6-8)14-9-4-5-13-7-9;/h2-3,6,9,13H,4-5,7H2,1H3;1H
InChI key:InChIKey=UHQMLBCZBGKJQF-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(C)C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(2-bromo-4-methylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.