CAS 1185298-14-9

Benzenamine, 4-[2-(1-methyl-1H-imidazol-2-yl)ethyl]-, hydrochloride (1:2)

Description:

Benzenamine, 4-[2-(1-methyl-1H-imidazol-2-yl)ethyl]-, hydrochloride (1:2), also known by its CAS number 1185298-14-9, is a chemical compound characterized by its amine functional group and an imidazole ring. This substance features a benzene ring substituted with an amino group and a side chain that includes a 1-methyl-1H-imidazole moiety. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its biological activity. The presence of the imidazole ring suggests potential applications in pharmaceuticals, particularly in drug design, due to its ability to participate in hydrogen bonding and its role in biological systems. The compound's structure may confer specific properties such as basicity and reactivity, making it of interest in various chemical and medicinal contexts. As with many amines, it may exhibit basic characteristics and can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions.

Formula: C₁₂H₁₅N₃.2ClH

InChI: InChI=1S/C12H15N3.2ClH/c1-15-9-8-14-12(15)7-4-10-2-5-11(13)6-3-10;;/h2-3,5-6,8-9H,4,7,13H2,1H3;2*1H

InChI key: InChIKey=XYMDESUQALAEGZ-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(N)C=C1)C=2N(C)C=CN2.Cl