CAS 1185298-32-1

4-Pyridinemethanamine, N-(1,3-benzodioxol-5-ylmethyl)-, hydrobromide (1:1)

Description:

4-Pyridinemethanamine, N-(1,3-benzodioxol-5-ylmethyl)-, hydrobromide (1:1) is a chemical compound characterized by its pyridine and benzodioxole moieties, which contribute to its unique properties. The presence of the hydrobromide indicates that it is a salt form, enhancing its solubility in polar solvents, which is often beneficial for biological activity. This compound may exhibit pharmacological properties due to its structural features, potentially interacting with biological targets. The benzodioxole group is known for its role in various medicinal compounds, often associated with antioxidant and anti-inflammatory activities. Additionally, the pyridine ring can participate in hydrogen bonding and coordination with metal ions, influencing its reactivity and stability. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific applications and biological activities would require further investigation through experimental studies. Safety data and handling precautions should be adhered to, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₄H₁₄N₂O₂·BrH

InChI: InChI=1S/C14H14N2O2.BrH/c1-2-13-14(18-10-17-13)7-12(1)9-16-8-11-3-5-15-6-4-11;/h1-7,16H,8-10H2;1H

InChI key: InChIKey=VBXVSUCAKOJPLC-UHFFFAOYSA-N

SMILES: C(NCC=1C=CN=CC1)C=2C=C3C(=CC2)OCO3.Br

Synonyms:

• 4-Pyridinemethanamine, N-(1,3-benzodioxol-5-ylmethyl)-, hydrobromide (1:1)