
CAS 1185298-41-2
:Piperidine, 4-(2,4-dichlorophenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 4-(2,4-dichlorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 2,4-dichlorophenoxy group, indicating the presence of a phenolic moiety substituted with two chlorine atoms at the 2 and 4 positions, enhancing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential psychoactive properties, while the dichlorophenoxy group may contribute to herbicidal or antimicrobial activities. This compound is of interest in medicinal chemistry and may be studied for its interactions with biological targets. Safety data should be consulted for handling and usage, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C11H13Cl2NO·ClH
InChI:InChI=1S/C11H13Cl2NO.ClH/c12-8-1-2-11(10(13)7-8)15-9-3-5-14-6-4-9;/h1-2,7,9,14H,3-6H2;1H
InChI key:InChIKey=KSTFWHGADZMXAS-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(Cl)C=C1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-(2,4-dichlorophenoxy)-, hydrochloride (1:1)
- 4-(2,4-Dichlorophenoxy)piperidine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.