CAS 1185298-42-3

Pyrrolidine, 3-[(4-methylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-methylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 4-methylphenoxy group attached to the third carbon of the pyrrolidine ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with biological targets, potentially influencing neurotransmitter systems or other physiological pathways. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of organic molecules that may have applications in drug development or research.

Formula: C₁₂H₁₇NO·ClH

InChI: InChI=1S/C12H17NO.ClH/c1-10-2-4-12(5-3-10)14-9-11-6-7-13-8-11;/h2-5,11,13H,6-9H2,1H3;1H

InChI key: InChIKey=GQLXKOJQRTWOLN-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC=C(C)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-methylphenoxy)methyl]-, hydrochloride (1:1)