CAS 1185298-50-3

Pyrrolidine, 3-[2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[2-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a phenoxy group, specifically a 2-(1-methylethyl)phenoxy substituent, indicates that the compound has a branched alkyl group attached to the aromatic ring, contributing to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various biological activities, potentially including effects on the central nervous system or other physiological pathways, depending on its specific interactions with biological targets. Its structural features suggest it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-10(2)12-5-3-4-6-13(12)15-11-7-8-14-9-11;/h3-6,10-11,14H,7-9H2,1-2H3;1H

InChI key: InChIKey=ATZPAIIOEIECEU-UHFFFAOYSA-N

SMILES: O(C1=C(C(C)C)C=CC=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-[2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)