CAS 1185298-53-6

Pyrrolidine, 3-[(2-naphthalenyloxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(2-naphthalenyloxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a naphthalenyloxy group at the 3-position of the pyrrolidine ring contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly affecting neurotransmitter systems or other cellular pathways. Safety and handling precautions are essential, as with any chemical substance, particularly those with biological activity. Further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential therapeutic applications.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-2-4-14-9-15(6-5-13(14)3-1)17-11-12-7-8-16-10-12;/h1-6,9,12,16H,7-8,10-11H2;1H

InChI key: InChIKey=JCRAFFZLSWPLTE-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC3=C(C=C2)C=CC=C3.Cl

Synonyms:

• Pyrrolidine, 3-[(2-naphthalenyloxy)methyl]-, hydrochloride (1:1)