
CAS 1185298-56-9
:Pyrrolidine, 3-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a phenoxy group, specifically a para-substituted tert-butylphenyl moiety, contributes to its hydrophobic properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for specific receptors or enzymes. Its structural features suggest it could be involved in interactions with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.
Formula:C15H23NO·ClH
InChI:InChI=1S/C15H23NO.ClH/c1-15(2,3)13-4-6-14(7-5-13)17-11-12-8-9-16-10-12;/h4-7,12,16H,8-11H2,1-3H3;1H
InChI key:InChIKey=RKAFBXFTNCZZGB-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=CC=C(C(C)(C)C)C=C2.Cl
Synonyms:- Pyrrolidine, 3-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.