CymitQuimica logo

CAS 1185298-69-4

:

Pyrrolidine, 3-(3-bromophenoxy)-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-(3-bromophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 3-bromophenoxy group indicates that a bromine atom is substituted on a phenyl ring, which is further connected to the pyrrolidine at the 3-position. This compound exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The hydrochloride form typically indicates that the compound can be used in biological systems, potentially exhibiting pharmacological activity. Its molecular structure suggests that it may interact with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. As with many organic compounds, safety and handling precautions should be observed, as the presence of halogens like bromine can impart specific toxicological properties. Overall, this compound's unique structure and properties make it of interest in research and development within the field of organic and medicinal chemistry.
Formula:C10H12BrNO.ClH
InChI:InChI=1S/C10H12BrNO.ClH/c11-8-2-1-3-9(6-8)13-10-4-5-12-7-10;/h1-3,6,10,12H,4-5,7H2;1H
InChI key:InChIKey=CBHYADKFFREZNK-UHFFFAOYSA-N
SMILES:O(C1=CC(Br)=CC=C1)C2CCNC2.Cl
Found 4 products.