CAS 1185298-81-0

Piperidine, 4-(cyclohexylmethoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(cyclohexylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a cyclohexylmethoxy group at the 4-position of the piperidine ring contributes to its unique properties, potentially influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical and chemical research. The compound may exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, although specific pharmacological data would be necessary to elucidate its effects. Safety data sheets and handling guidelines should be consulted for proper handling, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₁₂H₂₃NO·ClH

InChI: InChI=1S/C12H23NO.ClH/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12;/h11-13H,1-10H2;1H

InChI key: InChIKey=KHIDKNUDQAYVOP-UHFFFAOYSA-N

SMILES: C(OC1CCNCC1)C2CCCCC2.Cl

Synonyms:

• Piperidine, 4-(cyclohexylmethoxy)-, hydrochloride (1:1)