
CAS 1185298-83-2
:1,2,4-Oxadiazole-3-methanamine, 5-ethyl-, hydrochloride (1:1)
Description:
1,2,4-Oxadiazole-3-methanamine, 5-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an amine functional group, contributing to its potential as a building block in pharmaceuticals and agrochemicals. The presence of the ethyl group enhances its lipophilicity, which may influence its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in various applications. The compound's unique structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its properties may include moderate to high melting points and specific reactivity patterns typical of oxadiazole derivatives. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C5H9N3O·ClH
InChI:InChI=1S/C5H9N3O.ClH/c1-2-5-7-4(3-6)8-9-5;/h2-3,6H2,1H3;1H
InChI key:InChIKey=KZYHGQUHTYERMK-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(CC)ON1.Cl
Synonyms:- 1,2,4-Oxadiazole-3-methanamine, 5-ethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.