CAS 1185298-88-7

1H-1,4-Diazepine-1-methanol, 2-ethylhexahydro-, hydrochloride (1:2)

Description:

1H-1,4-Diazepine-1-methanol, 2-ethylhexahydro-, hydrochloride (1:2) is a chemical compound characterized by its diazepine structure, which consists of a seven-membered ring containing two nitrogen atoms. This compound features a methanol group attached to the diazepine ring, contributing to its solubility and reactivity. The presence of the 2-ethyl group enhances its hydrophobic characteristics, potentially influencing its biological activity and interactions. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties associated with psychoactive substances, given the diazepine framework, which is known for its effects on the central nervous system. However, specific pharmacological effects and safety profiles would require further investigation through empirical studies. Overall, this compound's unique structural features and salt form suggest potential utility in medicinal chemistry and related fields.

Formula: C₈H₁₈N₂O·2ClH

InChI: InChI=1S/C8H18N2O.2ClH/c1-2-8-6-9-4-3-5-10(8)7-11;;/h8-9,11H,2-7H2,1H3;2*1H

InChI key: InChIKey=WQARKPFMTJKYJE-UHFFFAOYSA-N

SMILES: C(C)C1N(CO)CCCNC1.Cl

Synonyms:

• 1H-1,4-Diazepine-1-methanol, 2-ethylhexahydro-, hydrochloride (1:2)