CAS 1185299-08-4

Hydrazine, [(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:

Hydrazine, [(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine backbone, which is known for its reducing properties and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the 2-chloro-6-fluorophenyl group contributes to its unique reactivity and biological activity, potentially influencing its pharmacokinetics and mechanism of action. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which enhances its usability in formulations. This compound may exhibit specific toxicological profiles, necessitating careful handling and assessment of safety data. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies on its efficacy, safety, and environmental impact are essential for understanding its full potential and limitations in practical applications.

Formula: C₇H₈ClFN₂·2ClH

InChI: InChI=1S/C7H8ClFN2.2ClH/c8-6-2-1-3-7(9)5(6)4-11-10;;/h1-3,11H,4,10H2;2*1H

InChI key: InChIKey=IGZQPEVQJOUSKG-UHFFFAOYSA-N

SMILES: C(NN)C1=C(Cl)C=CC=C1F.Cl

Synonyms:

• Hydrazine, [(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:2)