CAS 1185299-23-3

Piperidine, 3-[(2-phenylethoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(2-phenylethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenylethoxy group attached to the third position of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the phenylethoxy moiety may impart specific biological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its hydrochloride form indicates that it may exhibit different stability and solubility characteristics compared to its free base form. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₂₁NO.ClH

InChI: InChI=1S/C14H21NO.ClH/c1-2-5-13(6-3-1)8-10-16-12-14-7-4-9-15-11-14;/h1-3,5-6,14-15H,4,7-12H2;1H

InChI key: InChIKey=ZAXOUPSMEPPJOY-UHFFFAOYSA-N

SMILES: C(COCC1CCCNC1)C2=CC=CC=C2.Cl