
CAS 1185299-30-2
:Piperidine, 3-(2-fluorophenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(2-fluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 2-fluorophenoxy group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C11H14FNO·ClH
InChI:InChI=1S/C11H14FNO.ClH/c12-10-5-1-2-6-11(10)14-9-4-3-7-13-8-9;/h1-2,5-6,9,13H,3-4,7-8H2;1H
InChI key:InChIKey=MXLIXTWBZSBJST-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=CC=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(2-fluorophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.