
CAS 1185299-33-5
:Benzenemethanamine, 4-(3,5-dimethyl-1H-pyrazol-1-yl)-N-methyl-, hydrochloride (1:2)
Description:
Benzenemethanamine, 4-(3,5-dimethyl-1H-pyrazol-1-yl)-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a benzene ring, a methanamine group, and a pyrazole moiety. The presence of the 3,5-dimethyl-1H-pyrazole indicates that it has two methyl groups attached to the pyrazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways, although specific pharmacological effects would depend on further studies. Its molecular interactions, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular geometry. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C13H17N3·2ClH
InChI:InChI=1S/C13H17N3.2ClH/c1-10-8-11(2)16(15-10)13-6-4-12(5-7-13)9-14-3;;/h4-8,14H,9H2,1-3H3;2*1H
InChI key:InChIKey=PGGBOPIGANWEOU-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1)C2=CC=C(CNC)C=C2.Cl
Synonyms:- Benzenemethanamine, 4-(3,5-dimethyl-1H-pyrazol-1-yl)-N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.