
CAS 1185299-34-6
:Ethanone, 1-[1,4′-bipiperidin]-1′-yl-2-chloro-, hydrochloride (1:1)
Description:
Ethanone, 1-[1,4′-bipiperidin]-1′-yl-2-chloro-, hydrochloride (1:1), with the CAS number 1185299-34-6, is a chemical compound characterized by its structural features that include a bipiperidine moiety and a chloro group attached to an ethanone framework. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the bipiperidine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The chloro substituent may also impart specific reactivity or stability characteristics. As a hydrochloride, it is likely to exhibit properties such as increased stability and ease of handling compared to its free base form. Overall, this compound's unique structural attributes contribute to its potential utility in research and therapeutic contexts, although specific applications would depend on further studies and evaluations of its pharmacological properties.
Formula:C12H21ClN2O·ClH
InChI:InChI=1S/C12H21ClN2O.ClH/c13-10-12(16)15-8-4-11(5-9-15)14-6-2-1-3-7-14;/h11H,1-10H2;1H
InChI key:InChIKey=QKYPEPUXTDMGGN-UHFFFAOYSA-N
SMILES:C(CCl)(=O)N1CCC(CC1)N2CCCCC2.Cl
Synonyms:- Ethanone, 1-[1,4′-bipiperidin]-1′-yl-2-chloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.