CAS 1185299-37-9

Benzenamine, 2-(2-pyridinylmethoxy)-, hydrochloride (1:2)

Description:

Benzenamine, 2-(2-pyridinylmethoxy)-, hydrochloride (1:2), also known by its CAS number 1185299-37-9, is a chemical compound characterized by its amine and ether functional groups. This substance features a benzenamine core, which is an aromatic amine, and a pyridinylmethoxy substituent, indicating the presence of a pyridine ring linked through a methoxy group. The hydrochloride form suggests that the compound is a salt, which enhances its solubility in water and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The presence of both aromatic and heterocyclic structures often contributes to the compound's stability and reactivity. Additionally, the hydrochloride salt form can affect the compound's pharmacokinetics, including absorption and distribution in biological systems. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.

Formula: C₁₂H₁₂N₂O·2ClH

InChI: InChI=1S/C12H12N2O.2ClH/c13-11-6-1-2-7-12(11)15-9-10-5-3-4-8-14-10;;/h1-8H,9,13H2;2*1H

InChI key: InChIKey=MIJDDIMQMYTBGD-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=N1)C2=C(N)C=CC=C2.Cl

Synonyms:

• Benzenamine, 2-(2-pyridinylmethoxy)-, hydrochloride (1:2)