CymitQuimica logo

CAS 1185299-39-1

:

Pyrrolidine, 3-(2-ethylphenoxy)-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-(2-ethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a 2-ethylphenoxy group, indicating the presence of an ethyl-substituted phenyl moiety attached via an ether linkage. As a hydrochloride salt, it exists in a stable form that enhances its solubility in water, making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride indicates that the compound can form a protonated species, which may influence its reactivity and biological activity. Pyrrolidine derivatives are often studied for their potential pharmacological properties, including effects on the central nervous system. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a unique structure that may have implications in medicinal chemistry and drug development.
Formula:C12H17NO·ClH
InChI:InChI=1S/C12H17NO.ClH/c1-2-10-5-3-4-6-12(10)14-11-7-8-13-9-11;/h3-6,11,13H,2,7-9H2,1H3;1H
InChI key:InChIKey=JDWYZLSEBPJHGR-UHFFFAOYSA-N
SMILES:O(C1=C(CC)C=CC=C1)C2CCNC2.Cl
Synonyms:
  • Pyrrolidine, 3-(2-ethylphenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.