
CAS 1185299-43-7
:3-Piperidinecarboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1)
Description:
3-Piperidinecarboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The substitution of a chloro and fluorine atom on the phenyl ring suggests that the compound may possess unique electronic properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry. The compound's specific interactions with biological targets can be influenced by its structural features, which may lead to potential therapeutic uses. However, detailed studies would be necessary to fully understand its pharmacodynamics and pharmacokinetics. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can have implications for toxicity and environmental impact.
Formula:C13H15ClFNO2·ClH
InChI:InChI=1S/C13H15ClFNO2.ClH/c14-11-4-1-5-12(15)10(11)8-16-6-2-3-9(7-16)13(17)18;/h1,4-5,9H,2-3,6-8H2,(H,17,18);1H
InChI key:InChIKey=KJMRTMSIJHZBNY-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CCC1)C2=C(Cl)C=CC=C2F.Cl
Synonyms:- 3-Piperidinecarboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.