CAS 1185299-48-2

4-Pyridinemethanamine, α,α-di-2-propen-1-yl-, hydrochloride (1:2)

Description:

4-Pyridinemethanamine, α,α-di-2-propen-1-yl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming salts. The presence of the α,α-di-2-propen-1-yl group indicates that it has two propenyl substituents, which can influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound represents a unique combination of functional groups that may lead to diverse applications in research and industry.

Formula: C₁₂H₁₆N₂·2ClH

InChI: InChI=1S/C12H16N2.2ClH/c1-3-7-12(13,8-4-2)11-5-9-14-10-6-11;;/h3-6,9-10H,1-2,7-8,13H2;2*1H

InChI key: InChIKey=INEAAMDLJWDBED-UHFFFAOYSA-N

SMILES: C(CC=C)(CC=C)(N)C=1C=CN=CC1.Cl

Synonyms:

• 4-Pyridinemethanamine, α,α-di-2-propen-1-yl-, hydrochloride (1:2)