
CAS 1185299-54-0
:4-Piperidinemethanamine, N-[2-(4-methoxyphenyl)ethyl]-1-methyl-, hydrochloride (1:2)
Description:
4-Piperidinemethanamine, N-[2-(4-methoxyphenyl)ethyl]-1-methyl-, hydrochloride (1:2), with the CAS number 1185299-54-0, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features a methanamine group and a substituted phenyl group, specifically a 4-methoxyphenyl moiety, which contributes to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the methoxy group may influence its pharmacokinetic properties, such as absorption and distribution. As a tertiary amine, it may exhibit basic properties, and its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies.
Formula:C16H27ClN2O
InChI:InChI=1S/C16H26N2O.2ClH/c1-18-11-8-15(9-12-18)13-17-10-7-14-3-5-16(19-2)6-4-14;;/h3-6,15,17H,7-13H2,1-2H3;2*1H
InChI key:InChIKey=OCPZWROLTULTEY-UHFFFAOYSA-N
SMILES:C(CNCC1CCN(C)CC1)C2=CC=C(OC)C=C2.Cl
Synonyms:- 4-Piperidinemethanamine, N-[2-(4-methoxyphenyl)ethyl]-1-methyl-, hydrochloride (1:2)
- 2-(4-Methoxyphenyl)-N-((1-methylpiperidin-4-yl)methyl)ethanamine dihydrochloride
- 2-(4-methoxyphenyl)-N-[(1-methylpiperidin-4-yl)methyl]ethanamine
- [2-(4-METHOXYPHENYL)ETHYL][(1-METHYLPIPERIDIN-4-YL)METHYL]AMINE DIHYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.