CAS 1185299-59-5

Pyrrolidine, 3-(4-fluoro-2-methylphenoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(4-fluoro-2-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 4-fluoro-2-methylphenoxy group indicates that the compound has a phenolic structure with a fluorine atom and a methyl group attached to the aromatic ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the fluorine atom, which can affect lipophilicity and binding affinity to biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further characterization would typically involve techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.

Formula: C₁₁H₁₄FNO·ClH

InChI: InChI=1S/C11H14FNO.ClH/c1-8-6-9(12)2-3-11(8)14-10-4-5-13-7-10;/h2-3,6,10,13H,4-5,7H2,1H3;1H

InChI key: InChIKey=HBZCUJSOMQVVND-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=C(F)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(4-fluoro-2-methylphenoxy)-, hydrochloride (1:1)

3-(4-Fluoro-2-methylphenoxy)pyrrolidinehydrochloride

CAS: 1185299-59-5

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 231.69 g/mol

Ref: 3D-KXB29959