CAS 1185299-71-1

Ethanamine, 2-(1-piperazinylsulfonyl)-, ethanedioate (1:1)

Description:

Ethanamine, 2-(1-piperazinylsulfonyl)-, ethanedioate (1:1), also known by its CAS number 1185299-71-1, is a chemical compound characterized by its dual functional groups. The presence of the ethanamine moiety suggests it has amine characteristics, which may contribute to basicity and potential nucleophilicity. The piperazinylsulfonyl group indicates that the compound contains a piperazine ring, which is often associated with biological activity, particularly in pharmaceuticals. The ethanedioate component implies the presence of a dicarboxylic acid derivative, which can influence solubility and reactivity. This compound may exhibit properties such as moderate solubility in polar solvents and potential interactions with biological targets due to its amine and sulfonyl functionalities. Its structural features suggest it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₆H₁₅N₃O₂S·C₂H₂O₄

InChI: InChI=1S/C6H15N3O2S.C2H2O4/c7-1-6-12(10,11)9-4-2-8-3-5-9;3-1(4)2(5)6/h8H,1-7H2;(H,3,4)(H,5,6)

InChI key: InChIKey=WZBFTYIGONMQLT-UHFFFAOYSA-N

SMILES: S(CCN)(=O)(=O)N1CCNCC1.C(C(O)=O)(O)=O

Synonyms:

• Ethanamine, 2-(1-piperazinylsulfonyl)-, ethanedioate (1:1)