
CAS 1185299-81-3
:Piperidine, 4-(2-ethoxyethyl)-, hydrochloride (1:1)
Description:
Piperidine, 4-(2-ethoxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 2-ethoxyethyl substituent introduces an ethoxy group, contributing to its solubility and potential reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit properties typical of piperidine derivatives, such as acting as a base and potentially participating in nucleophilic reactions. Its hydrochloride form suggests it may be used in various applications, including pharmaceuticals, where it could serve as an intermediate or active ingredient. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is synthesized or stored. As with many piperidine derivatives, it may also possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H19NO·ClH
InChI:InChI=1S/C9H19NO.ClH/c1-2-11-8-5-9-3-6-10-7-4-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=JCPJBVUIQXVBCD-UHFFFAOYSA-N
SMILES:C(COCC)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-(2-ethoxyethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.