CymitQuimica logo

CAS 1185299-92-6

:

4-Quinolinecarboxylic acid, 2-(1-piperazinyl)-, hydrochloride (1:1)

Description:
4-Quinolinecarboxylic acid, 2-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its quinoline and piperazine moieties, which contribute to its biological activity and potential pharmacological applications. This substance typically appears as a white to off-white crystalline powder and is soluble in water, reflecting its hydrochloride salt form. The presence of the quinoline ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly for its possible roles in treating various conditions. The piperazine group enhances its pharmacokinetic properties, such as solubility and receptor binding affinity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data should be consulted for handling and exposure guidelines, as with any chemical compound, to ensure proper laboratory practices. Overall, this compound's unique structure positions it as a candidate for further research in drug development and therapeutic applications.
Formula:C14H15N3O2·ClH
InChI:InChI=1S/C14H15N3O2.ClH/c18-14(19)11-9-13(17-7-5-15-6-8-17)16-12-4-2-1-3-10(11)12;/h1-4,9,15H,5-8H2,(H,18,19);1H
InChI key:InChIKey=JILRWYXZNHPYPI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)N3CCNCC3)C=CC=C2.Cl
Synonyms:
  • 4-Quinolinecarboxylic acid, 2-(1-piperazinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.