CAS 1185299-94-8

1H-Tetrazole-1-acetic acid, 5-[(2,6-dimethyl-4-morpholinyl)methyl]-, hydrochloride (1:1)

Description:

1H-Tetrazole-1-acetic acid, 5-[(2,6-dimethyl-4-morpholinyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. This compound features an acetic acid functional group, contributing to its acidity and potential for forming salts. The presence of a morpholine moiety, specifically 2,6-dimethyl-4-morpholinyl, indicates that it has a cyclic amine structure, which can enhance its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further studies. Its unique structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₇N₅O₃·ClH

InChI: InChI=1S/C10H17N5O3.ClH/c1-7-3-14(4-8(2)18-7)5-9-11-12-13-15(9)6-10(16)17;/h7-8H,3-6H2,1-2H3,(H,16,17);1H

InChI key: InChIKey=SMEAYYKJTFAWIG-UHFFFAOYSA-N

SMILES: C(C=1N(CC(O)=O)N=NN1)N2CC(C)OC(C)C2.Cl

Synonyms:

• 1H-Tetrazole-1-acetic acid, 5-[(2,6-dimethyl-4-morpholinyl)methyl]-, hydrochloride (1:1)