
CAS 1185299-95-9
:Piperazine, 1-[(3-methyl-2-pyridinyl)methyl]-, hydrochloride (1:2)
Description:
Piperazine, 1-[(3-methyl-2-pyridinyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a pyridine ring substituted with a methyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The presence of the pyridine moiety may impart specific pharmacological activities, making it of interest in medicinal chemistry. The compound is likely to exhibit basic properties due to the piperazine nitrogen atoms, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential uses in drug development, particularly in areas related to central nervous system activity or as an antimicrobial agent. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H17N3·2ClH
InChI:InChI=1S/C11H17N3.2ClH/c1-10-3-2-4-13-11(10)9-14-7-5-12-6-8-14;;/h2-4,12H,5-9H2,1H3;2*1H
InChI key:InChIKey=AKNZXOWZWTVZLX-UHFFFAOYSA-N
SMILES:C(C1=C(C)C=CC=N1)N2CCNCC2.Cl
Synonyms:- Piperazine, 1-[(3-methyl-2-pyridinyl)methyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.