CAS 1185299-96-0

Pyrido[4,3-d]pyrimidin-4-amine, 5,6,7,8-tetrahydro-N,6-dimethyl-2-(3-piperidinyl)-, hydrochloride (1:2)

Description:

Pyrido[4,3-d]pyrimidin-4-amine, 5,6,7,8-tetrahydro-N,6-dimethyl-2-(3-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes a dimethyl group and a piperidine moiety, contributing to its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The presence of amine functional groups suggests it may engage in hydrogen bonding, influencing its interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential use in drug development, possibly targeting various neurological or oncological pathways. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. As with many compounds in this class, safety and handling precautions are essential due to potential biological activity.

Formula: C₁₄H₂₃N₅·2ClH

InChI: InChI=1S/C14H23N5.2ClH/c1-15-14-11-9-19(2)7-5-12(11)17-13(18-14)10-4-3-6-16-8-10;;/h10,16H,3-9H2,1-2H3,(H,15,17,18);2*1H

InChI key: InChIKey=ZFDNRNDIOGLJRM-UHFFFAOYSA-N

SMILES: N(C)C1=C2C(=NC(=N1)C3CCCNC3)CCN(C)C2.Cl

Synonyms:

• Pyrido[4,3-d]pyrimidin-4-amine, 5,6,7,8-tetrahydro-N,6-dimethyl-2-(3-piperidinyl)-, hydrochloride (1:2)