
CAS 1185300-00-8
:2-Piperazinone, 1-cyclopentyl-, hydrochloride (1:1)
Description:
2-Piperazinone, 1-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of a cyclopentyl group indicates that a cyclopentane ring is attached to the piperazinone, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further research is necessary to fully elucidate its properties and potential applications in drug development or other fields.
Formula:C9H16N2O·ClH
InChI:InChI=1S/C9H16N2O.ClH/c12-9-7-10-5-6-11(9)8-3-1-2-4-8;/h8,10H,1-7H2;1H
InChI key:InChIKey=LRCZUYWNKQREEG-UHFFFAOYSA-N
SMILES:O=C1N(C2CCCC2)CCNC1.Cl
Synonyms:- 1-Cyclopentylpiperazin-2-one hydrochloride
- 2-Piperazinone, 1-cyclopentyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.