CAS 1185300-01-9

1H-Benzimidazol-5-amine, 1-cyclohexyl-2-methyl-, hydrochloride (1:2)

Description:

1H-Benzimidazol-5-amine, 1-cyclohexyl-2-methyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an amine group at the 5-position and a cyclohexyl and methyl substituent at the 1 and 2 positions, respectively. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the amine group suggests potential basicity and reactivity, which may contribute to its biological activity. The compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. Overall, this compound represents a class of heterocyclic amines that may exhibit diverse pharmacological effects.

Formula: C₁₄H₁₉N₃·2ClH

InChI: InChI=1S/C14H19N3.2ClH/c1-10-16-13-9-11(15)7-8-14(13)17(10)12-5-3-2-4-6-12;;/h7-9,12H,2-6,15H2,1H3;2*1H

InChI key: InChIKey=HTZKTXKZKVZREW-UHFFFAOYSA-N

SMILES: CC=1N(C=2C(N1)=CC(N)=CC2)C3CCCCC3.Cl

Synonyms:

• 1H-Benzimidazol-5-amine, 1-cyclohexyl-2-methyl-, hydrochloride (1:2)