CAS 1185300-02-0

1,4-Benzodioxin-6-methanamine, α-2-furanyl-2,3-dihydro-, hydrochloride (1:1)

Description:

1,4-Benzodioxin-6-methanamine, α-2-furanyl-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzodioxin core and a furan moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methanamine group suggests it may engage in hydrogen bonding and participate in various chemical reactions, making it of interest in medicinal chemistry. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The compound may exhibit pharmacological properties, potentially acting as a ligand for various biological targets. Its specific applications and effects would depend on further research, including studies on its mechanism of action, toxicity, and therapeutic potential. Overall, this compound represents a class of substances that may have implications in drug development and other chemical applications.

Formula: C₁₃H₁₃NO₃·ClH

InChI: InChI=1S/C13H13NO3.ClH/c14-13(11-2-1-5-15-11)9-3-4-10-12(8-9)17-7-6-16-10;/h1-5,8,13H,6-7,14H2;1H

InChI key: InChIKey=HWZSLLKJISQCBE-UHFFFAOYSA-N

SMILES: C(N)(C=1C=C2C(=CC1)OCCO2)C3=CC=CO3.Cl

Synonyms:

• 1,4-Benzodioxin-6-methanamine, α-2-furanyl-2,3-dihydro-, hydrochloride (1:1)