CAS 1185300-03-1

4H-Pyrido[1,2-a]pyrimidine-3-carboxylic acid, 4-oxo-, hydrochloride (1:1)

Description:

4H-Pyrido[1,2-a]pyrimidine-3-carboxylic acid, 4-oxo-, hydrochloride (1:1) is a heterocyclic compound characterized by its pyridine and pyrimidine ring structures. This compound features a carboxylic acid functional group and a keto group, contributing to its acidic properties and potential reactivity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances solubility in water and can influence its biological activity. The presence of nitrogen atoms in the ring structures may impart unique electronic properties, making it of interest in medicinal chemistry and drug development. Such compounds are often studied for their potential pharmacological applications, including antimicrobial or anticancer activities. The molecular structure allows for various interactions with biological targets, which can be explored in research settings. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in experimental designs.

Formula: C₉H₆N₂O₃·ClH

InChI: InChI=1S/C9H6N2O3.ClH/c12-8-6(9(13)14)5-10-7-3-1-2-4-11(7)8;/h1-5H,(H,13,14);1H

InChI key: InChIKey=LSIGZSGHORQZTP-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC=C1C(O)=O)C=CC=C2.Cl

Synonyms:

• 4H-Pyrido[1,2-a]pyrimidine-3-carboxylic acid, 4-oxo-, hydrochloride (1:1)