
CAS 1185300-31-5
:8-Azabicyclo[3.2.1]octane, 3-(1-pyrrolidinyl)-, hydrochloride (1:2)
Description:
8-Azabicyclo[3.2.1]octane, 3-(1-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the bicyclic framework, contributing to its classification as a bicyclic amine. The presence of the pyrrolidinyl group enhances its potential for interaction with biological systems, particularly in the context of pharmacology. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including medicinal chemistry. The compound may exhibit properties such as psychoactive effects or potential use as a precursor in the synthesis of other pharmacologically active substances. Its specific interactions and effects would depend on its molecular structure and the functional groups present. Safety and handling precautions are essential, as with any chemical substance, particularly those with psychoactive potential. Further research would be necessary to fully elucidate its biological activity and potential therapeutic applications.
Formula:C11H20N2·2ClH
InChI:InChI=1S/C11H20N2.2ClH/c1-2-6-13(5-1)11-7-9-3-4-10(8-11)12-9;;/h9-12H,1-8H2;2*1H
InChI key:InChIKey=VMBQNSJOFQJMTE-UHFFFAOYSA-N
SMILES:C1(CC2NC(C1)CC2)N3CCCC3.Cl
Synonyms:- 8-Azabicyclo[3.2.1]octane, 3-(1-pyrrolidinyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.