CymitQuimica logo

CAS 1185300-35-9

:

1H-1,2,4-Triazol-3-amine, 1-methyl-, hydrochloride (1:2)

Description:
1H-1,2,4-Triazol-3-amine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form. The presence of the methyl group at the 1-position of the triazole ring contributes to its unique chemical properties, potentially influencing its solubility and reactivity. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. Its molecular interactions are largely dictated by the functional groups present, which can engage in hydrogen bonding and other intermolecular forces. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, interacting with metal ions. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C3H6N4·2ClH
InChI:InChI=1S/C3H6N4.2ClH/c1-7-2-5-3(4)6-7;;/h2H,1H3,(H2,4,6);2*1H
InChI key:InChIKey=TUHSACJUFKEVCZ-UHFFFAOYSA-N
SMILES:NC1=NN(C)C=N1.Cl
Synonyms:
  • 1H-1,2,4-Triazol-3-amine, 1-methyl-, hydrochloride (1:2)
  • 1-Methyl-1H-1,2,4-triazol-3-amine dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.