CAS 1185300-50-8: 1H-Pyrazol-4-amine, 1-ethyl-5-methyl-, hydrochloride (1:1)
Description:1H-Pyrazol-4-amine, 1-ethyl-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amine functional group, contributing to its basicity and potential reactivity. The presence of ethyl and methyl substituents on the pyrazole ring influences its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially acting as a ligand or inhibitor in biochemical pathways. Its CAS number, 1185300-50-8, allows for precise identification in chemical databases. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.
Formula:C6H11N3·ClH
InChI:InChI=1S/C6H11N3.ClH/c1-3-9-5(2)6(7)4-8-9;/h4H,3,7H2,1-2H3;1H
InChI key:InChIKey=KRSOQFZSDQXOCI-UHFFFAOYSA-N
SMILES:Cl.N1=CC(N)=C(N1CC)C
- Synonyms:
- 1H-Pyrazol-4-amine, 1-ethyl-5-methyl-, hydrochloride (1:1)
1-Ethyl-5-methyl-4-aminopyrazole hydrochloride
Ref: IN-DA008US5
| 1g | 558.00 € | ||
| 250mg | 158.00 € |
4-Amino-1-ethyl-5-methyl-1H-pyrazole hydrochloride
Ref: 54-OR61323
| 250mg | 204.00 € | ||
| 500mg | 347.00 € |
Ref: FT-P12815
| 1g | To inquire | ||
| 500mg | To inquire |
1-ethyl-5-methyl-1H-pyrazol-4-amine hydrochloride
Ref: 10-F425632
| 1g | To inquire | ||
| 100mg | To inquire | ||
| 250mg | To inquire |
1-ethyl-5-methyl-1H-pyrazol-4-amine
Ref: 3D-FE75230
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
